C8H12N4O7S — CID 22824234
[(2R,3S,4R,5R)-5-(4-amino-2-oxo-1,3,5-triazin-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl hydrogen sulfite (PubChem CID 22824234) has the molecular formula C8H12N4O7S and a molecular weight of 308.27 g/mol. Its IUPAC name is [(2R,3S,4R,5R)-5-(4-amino-2-oxo-1,3,5-triazin-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl hydrogen sulfite.
| Compound Name | [(2R,3S,4R,5R)-5-(4-amino-2-oxo-1,3,5-triazin-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl hydrogen sulfite |
|---|---|
| PubChem CID | 22824234 |
| Molecular Formula | C8H12N4O7S |
| Molecular Weight | 308.27 g/mol |
| Exact Mass | 308.04 |
| IUPAC Name | [(2R,3S,4R,5R)-5-(4-amino-2-oxo-1,3,5-triazin-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl hydrogen sulfite |
| SMILES | Nc1ncn([C@@H]2O[C@H](COS(=O)O)[C@@H](O)[C@H]2O)c(=O)n1 |
| InChI | InChI=1S/C8H12N4O7S/c9-7-10-2-12(8(15)11-7)6-5(14)4(13)3(19-6)1-18-20(16)17/h2-6,13-14H,1H2,(H,16,17)(H2,9,11,15)/t3-,4-,5-,6-/m1/s1 |
| InChIKey | AKEYMKFVPRKGSB-KVTDHHQDSA-N |
| XLogP | -3.01 |
| TPSA | 170.02 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.27 |
| LogP ≤ 5 | -3.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|