C15H18N4O7 — CID 175594852
4-amino-1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-1,3,5-triazin-2-one;benzoic acid (PubChem CID 175594852) has the molecular formula C15H18N4O7 and a molecular weight of 366.33 g/mol. Its IUPAC name is 4-amino-1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-1,3,5-triazin-2-one;benzoic acid.
| Compound Name | 4-amino-1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-1,3,5-triazin-2-one;benzoic acid |
|---|---|
| PubChem CID | 175594852 |
| Molecular Formula | C15H18N4O7 |
| Molecular Weight | 366.33 g/mol |
| Exact Mass | 366.12 |
| IUPAC Name | 4-amino-1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-1,3,5-triazin-2-one;benzoic acid |
| SMILES | Nc1ncn([C@@H]2O[C@H](CO)[C@@H](O)[C@H]2O)c(=O)n1.O=C(O)c1ccccc1 |
| InChI | InChI=1S/C8H12N4O5.C7H6O2/c9-7-10-2-12(8(16)11-7)6-5(15)4(14)3(1-13)17-6;8-7(9)6-4-2-1-3-5-6/h2-6,13-15H,1H2,(H2,9,11,16);1-5H,(H,8,9)/t3-,4-,5-,6-;/m1./s1 |
| InChIKey | PUYTVCLNCDHGEZ-MVNLRXSJSA-N |
| XLogP | -1.78 |
| TPSA | 181.02 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.33 |
| LogP ≤ 5 | -1.78 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |