C17H18N4O8 — CID 174549240
benzoic acid;9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-3H-purine-2,6-dione (PubChem CID 174549240) has the molecular formula C17H18N4O8 and a molecular weight of 406.35 g/mol. Its IUPAC name is benzoic acid;9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-3H-purine-2,6-dione.
| Compound Name | benzoic acid;9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-3H-purine-2,6-dione |
|---|---|
| PubChem CID | 174549240 |
| Molecular Formula | C17H18N4O8 |
| Molecular Weight | 406.35 g/mol |
| Exact Mass | 406.11 |
| IUPAC Name | benzoic acid;9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-3H-purine-2,6-dione |
| SMILES | O=C(O)c1ccccc1.O=c1[nH]c(=O)c2ncn([C@@H]3O[C@H](CO)[C@@H](O)[C@H]3O)c2[nH]1 |
| InChI | InChI=1S/C10H12N4O6.C7H6O2/c15-1-3-5(16)6(17)9(20-3)14-2-11-4-7(14)12-10(19)13-8(4)18;8-7(9)6-4-2-1-3-5-6/h2-3,5-6,9,15-17H,1H2,(H2,12,13,18,19);1-5H,(H,8,9)/t3-,5-,6-,9-;/m1./s1 |
| InChIKey | DUMPMEKMDBZHCP-GWTDSMLYSA-N |
| XLogP | -1.59 |
| TPSA | 190.76 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.35 |
| LogP ≤ 5 | -1.59 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |