C10H12N4O6 — CID 171699514
9-[(3S)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-3H-purine-2,6-dione (PubChem CID 171699514) has the molecular formula C10H12N4O6 and a molecular weight of 284.23 g/mol. Its IUPAC name is 9-[(3S)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-3H-purine-2,6-dione.
| Compound Name | 9-[(3S)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-3H-purine-2,6-dione |
|---|---|
| PubChem CID | 171699514 |
| Molecular Formula | C10H12N4O6 |
| Molecular Weight | 284.23 g/mol |
| Exact Mass | 284.08 |
| IUPAC Name | 9-[(3S)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-3H-purine-2,6-dione |
| SMILES | O=c1[nH]c(=O)c2ncn(C3OC(CO)C(O)[C@@H]3O)c2[nH]1 |
| InChI | InChI=1S/C10H12N4O6/c15-1-3-5(16)6(17)9(20-3)14-2-11-4-7(14)12-10(19)13-8(4)18/h2-3,5-6,9,15-17H,1H2,(H2,12,13,18,19)/t3?,5?,6-,9?/m0/s1 |
| InChIKey | UBORTCNDUKBEOP-NWPBTAPWSA-N |
| XLogP | -2.98 |
| TPSA | 153.46 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.23 |
| LogP ≤ 5 | -2.98 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |