C15H15N8O11P — CID 175265142
(2,6-dioxo-3H-purin-9-yl) [(2R,3S,4R,5R)-5-(2,6-dioxo-3H-purin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl hydrogen phosphate (PubChem CID 175265142) has the molecular formula C15H15N8O11P and a molecular weight of 514.30 g/mol. Its IUPAC name is (2,6-dioxo-3H-purin-9-yl) [(2R,3S,4R,5R)-5-(2,6-dioxo-3H-purin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl hydrogen phosphate.
| Compound Name | (2,6-dioxo-3H-purin-9-yl) [(2R,3S,4R,5R)-5-(2,6-dioxo-3H-purin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl hydrogen phosphate |
|---|---|
| PubChem CID | 175265142 |
| Molecular Formula | C15H15N8O11P |
| Molecular Weight | 514.30 g/mol |
| Exact Mass | 514.06 |
| IUPAC Name | (2,6-dioxo-3H-purin-9-yl) [(2R,3S,4R,5R)-5-(2,6-dioxo-3H-purin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl hydrogen phosphate |
| SMILES | O=c1[nH]c(=O)c2ncn(OP(=O)(O)OC[C@H]3O[C@@H](n4cnc5c(=O)[nH]c(=O)[nH]c54)[C@H](O)[C@@H]3O)c2[nH]1 |
| InChI | InChI=1S/C15H15N8O11P/c24-7-4(33-13(8(7)25)22-2-16-5-9(22)18-14(28)20-11(5)26)1-32-35(30,31)34-23-3-17-6-10(23)19-15(29)21-12(6)27/h2-4,7-8,13,24-25H,1H2,(H,30,31)(H2,18,20,26,28)(H2,19,21,27,29)/t4-,7-,8-,13-/m1/s1 |
| InChIKey | HMJALWSSGOVHLZ-ODDSTHBYSA-N |
| XLogP | -4.00 |
| TPSA | 272.53 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.30 |
| LogP ≤ 5 | -4.00 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|