C15H26N5O7+ — CID 174274161
9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-3H-purine-2,6-dione;2-hydroxyethyl(trimethyl)azanium (PubChem CID 174274161) has the molecular formula C15H26N5O7+ and a molecular weight of 388.40 g/mol. Its IUPAC name is 9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-3H-purine-2,6-dione;2-hydroxyethyl(trimethyl)azanium.
| Compound Name | 9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-3H-purine-2,6-dione;2-hydroxyethyl(trimethyl)azanium |
|---|---|
| PubChem CID | 174274161 |
| Molecular Formula | C15H26N5O7+ |
| Molecular Weight | 388.40 g/mol |
| Exact Mass | 388.18 |
| IUPAC Name | 9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-3H-purine-2,6-dione;2-hydroxyethyl(trimethyl)azanium |
| SMILES | C[N+](C)(C)CCO.O=c1[nH]c(=O)c2ncn([C@@H]3O[C@H](CO)[C@@H](O)[C@H]3O)c2[nH]1 |
| InChI | InChI=1S/C10H12N4O6.C5H14NO/c15-1-3-5(16)6(17)9(20-3)14-2-11-4-7(14)12-10(19)13-8(4)18;1-6(2,3)4-5-7/h2-3,5-6,9,15-17H,1H2,(H2,12,13,18,19);7H,4-5H2,1-3H3/q;+1/t3-,5-,6-,9-;/m1./s1 |
| InChIKey | PRBFBULUQGVTLP-GWTDSMLYSA-N |
| XLogP | -3.29 |
| TPSA | 173.69 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.40 |
| LogP ≤ 5 | -3.29 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|