C10H14N4O12P2 — CID 174819933
[(2S,3R,4S,5S)-5-(2,6-dioxo-3H-purin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl phosphono hydrogen phosphate (PubChem CID 174819933) has the molecular formula C10H14N4O12P2 and a molecular weight of 444.19 g/mol. Its IUPAC name is [(2S,3R,4S,5S)-5-(2,6-dioxo-3H-purin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl phosphono hydrogen phosphate.
| Compound Name | [(2S,3R,4S,5S)-5-(2,6-dioxo-3H-purin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 174819933 |
| Molecular Formula | C10H14N4O12P2 |
| Molecular Weight | 444.19 g/mol |
| Exact Mass | 444.01 |
| IUPAC Name | [(2S,3R,4S,5S)-5-(2,6-dioxo-3H-purin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl phosphono hydrogen phosphate |
| SMILES | O=c1[nH]c(=O)c2ncn([C@H]3O[C@@H](COP(=O)(O)OP(=O)(O)O)[C@H](O)[C@@H]3O)c2[nH]1 |
| InChI | InChI=1S/C10H14N4O12P2/c15-5-3(1-24-28(22,23)26-27(19,20)21)25-9(6(5)16)14-2-11-4-7(14)12-10(18)13-8(4)17/h2-3,5-6,9,15-16H,1H2,(H,22,23)(H2,19,20,21)(H2,12,13,17,18)/t3-,5-,6-,9-/m0/s1 |
| InChIKey | YMOPVQQBWLGDOD-GIMIYPNGSA-N |
| XLogP | -2.74 |
| TPSA | 246.52 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.19 |
| LogP ≤ 5 | -2.74 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|