C12H19N4O15P3 — CID 54023360
[1-[(2S,3S,4R,5R)-5-(2,6-dioxo-3H-purin-9-yl)-3,4-dihydroxyoxolan-2-yl]propoxy-hydroxyphosphoryl] phosphono hydrogen phosphate (PubChem CID 54023360) has the molecular formula C12H19N4O15P3 and a molecular weight of 552.22 g/mol. Its IUPAC name is [1-[(2S,3S,4R,5R)-5-(2,6-dioxo-3H-purin-9-yl)-3,4-dihydroxyoxolan-2-yl]propoxy-hydroxyphosphoryl] phosphono hydrogen phosphate.
| Compound Name | [1-[(2S,3S,4R,5R)-5-(2,6-dioxo-3H-purin-9-yl)-3,4-dihydroxyoxolan-2-yl]propoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 54023360 |
| Molecular Formula | C12H19N4O15P3 |
| Molecular Weight | 552.22 g/mol |
| Exact Mass | 552.01 |
| IUPAC Name | [1-[(2S,3S,4R,5R)-5-(2,6-dioxo-3H-purin-9-yl)-3,4-dihydroxyoxolan-2-yl]propoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
| SMILES | CCC(OP(=O)(O)OP(=O)(O)OP(=O)(O)O)[C@H]1O[C@@H](n2cnc3c(=O)[nH]c(=O)[nH]c32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C12H19N4O15P3/c1-2-4(29-33(24,25)31-34(26,27)30-32(21,22)23)8-6(17)7(18)11(28-8)16-3-13-5-9(16)14-12(20)15-10(5)19/h3-4,6-8,11,17-18H,2H2,1H3,(H,24,25)(H,26,27)(H2,21,22,23)(H2,14,15,19,20)/t4?,6-,7+,8+,11+/m0/s1 |
| InChIKey | LALRCTTURVQSGX-ONBHVAQOSA-N |
| XLogP | -1.85 |
| TPSA | 293.05 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.22 |
| LogP ≤ 5 | -1.85 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|