C11H17N6O15P3 — CID 136749070
[[(2R,3S,4R,5R)-5-[2-(carbamoylamino)-6-oxo-1H-purin-9-yl]-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate (PubChem CID 136749070) has the molecular formula C11H17N6O15P3 and a molecular weight of 566.21 g/mol. Its IUPAC name is [[(2R,3S,4R,5R)-5-[2-(carbamoylamino)-6-oxo-1H-purin-9-yl]-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate.
| Compound Name | [[(2R,3S,4R,5R)-5-[2-(carbamoylamino)-6-oxo-1H-purin-9-yl]-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 136749070 |
| Molecular Formula | C11H17N6O15P3 |
| Molecular Weight | 566.21 g/mol |
| Exact Mass | 566.00 |
| IUPAC Name | [[(2R,3S,4R,5R)-5-[2-(carbamoylamino)-6-oxo-1H-purin-9-yl]-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
| SMILES | NC(=O)Nc1nc2c(ncn2[C@@H]2O[C@H](COP(=O)(O)OP(=O)(O)OP(=O)(O)O)[C@@H](O)[C@H]2O)c(=O)[nH]1 |
| InChI | InChI=1S/C11H17N6O15P3/c12-10(21)16-11-14-7-4(8(20)15-11)13-2-17(7)9-6(19)5(18)3(30-9)1-29-34(25,26)32-35(27,28)31-33(22,23)24/h2-3,5-6,9,18-19H,1H2,(H,25,26)(H,27,28)(H2,22,23,24)(H4,12,14,15,16,20,21)/t3-,5-,6-,9-/m1/s1 |
| InChIKey | APOWJUKVEYIEAU-UUOKFMHZSA-N |
| XLogP | -2.43 |
| TPSA | 328.20 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.21 |
| LogP ≤ 5 | -2.43 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|