C12H16N6O7 — CID 135457385
[6-oxo-9-[(2R,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]-1H-purin-2-yl]urea (PubChem CID 135457385) has the molecular formula C12H16N6O7 and a molecular weight of 356.30 g/mol. Its IUPAC name is [6-oxo-9-[(2R,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]-1H-purin-2-yl]urea.
| Compound Name | [6-oxo-9-[(2R,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]-1H-purin-2-yl]urea |
|---|---|
| PubChem CID | 135457385 |
| Molecular Formula | C12H16N6O7 |
| Molecular Weight | 356.30 g/mol |
| Exact Mass | 356.11 |
| IUPAC Name | [6-oxo-9-[(2R,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]-1H-purin-2-yl]urea |
| SMILES | NC(=O)Nc1nc2c(ncn2[C@@H]2O[C@H](CO)[C@H](O)[C@H](O)[C@H]2O)c(=O)[nH]1 |
| InChI | InChI=1S/C12H16N6O7/c13-11(24)17-12-15-8-4(9(23)16-12)14-2-18(8)10-7(22)6(21)5(20)3(1-19)25-10/h2-3,5-7,10,19-22H,1H2,(H4,13,15,16,17,23,24)/t3-,5+,6+,7-,10-/m1/s1 |
| InChIKey | KNIZDNXAWBIAFD-SEXAQLQKSA-N |
| XLogP | -3.42 |
| TPSA | 208.84 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.30 |
| LogP ≤ 5 | -3.42 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 10 |