C21H27N5O6 — CID 135912817
N-[9-[(2R,3S,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-6-oxo-1H-purin-2-yl]adamantane-1-carboxamide (PubChem CID 135912817) has the molecular formula C21H27N5O6 and a molecular weight of 445.48 g/mol. Its IUPAC name is N-[9-[(2R,3S,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-6-oxo-1H-purin-2-yl]adamantane-1-carboxamide.
| Compound Name | N-[9-[(2R,3S,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-6-oxo-1H-purin-2-yl]adamantane-1-carboxamide |
|---|---|
| PubChem CID | 135912817 |
| Molecular Formula | C21H27N5O6 |
| Molecular Weight | 445.48 g/mol |
| Exact Mass | 445.20 |
| IUPAC Name | N-[9-[(2R,3S,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-6-oxo-1H-purin-2-yl]adamantane-1-carboxamide |
| SMILES | O=C(Nc1nc2c(ncn2[C@@H]2O[C@H](CO)[C@@H](O)[C@@H]2O)c(=O)[nH]1)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C21H27N5O6/c27-7-12-14(28)15(29)18(32-12)26-8-22-13-16(26)23-20(24-17(13)30)25-19(31)21-4-9-1-10(5-21)3-11(2-9)6-21/h8-12,14-15,18,27-29H,1-7H2,(H2,23,24,25,30,31)/t9?,10?,11?,12-,14-,15+,18-,21?/m1/s1 |
| InChIKey | DXSQNFBMTNTWJN-PYYVJXOASA-N |
| XLogP | -0.11 |
| TPSA | 162.59 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.48 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |