C14H22N5O8P — CID 135507212
2-(diethoxyphosphorylamino)-9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-1H-purin-6-one (PubChem CID 135507212) has the molecular formula C14H22N5O8P and a molecular weight of 419.33 g/mol. Its IUPAC name is 2-(diethoxyphosphorylamino)-9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-1H-purin-6-one.
| Compound Name | 2-(diethoxyphosphorylamino)-9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-1H-purin-6-one |
|---|---|
| PubChem CID | 135507212 |
| Molecular Formula | C14H22N5O8P |
| Molecular Weight | 419.33 g/mol |
| Exact Mass | 419.12 |
| IUPAC Name | 2-(diethoxyphosphorylamino)-9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-1H-purin-6-one |
| SMILES | CCOP(=O)(Nc1nc2c(ncn2[C@@H]2O[C@H](CO)[C@@H](O)[C@H]2O)c(=O)[nH]1)OCC |
| InChI | InChI=1S/C14H22N5O8P/c1-3-25-28(24,26-4-2)18-14-16-11-8(12(23)17-14)15-6-19(11)13-10(22)9(21)7(5-20)27-13/h6-7,9-10,13,20-22H,3-5H2,1-2H3,(H2,16,17,18,23,24)/t7-,9-,10-,13-/m1/s1 |
| InChIKey | GMWMVPZQIZTYGE-QYVSTXNMSA-N |
| XLogP | -0.68 |
| TPSA | 181.05 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.33 |
| LogP ≤ 5 | -0.68 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|