C18H31N5O10P2 — CID 135546258
[(2R,3S,5R)-5-[2-(diethoxyphosphorylamino)-6-oxo-1H-purin-9-yl]-3-hydroxyoxolan-2-yl]methyl diethyl phosphate (PubChem CID 135546258) has the molecular formula C18H31N5O10P2 and a molecular weight of 539.42 g/mol. Its IUPAC name is [(2R,3S,5R)-5-[2-(diethoxyphosphorylamino)-6-oxo-1H-purin-9-yl]-3-hydroxyoxolan-2-yl]methyl diethyl phosphate.
| Compound Name | [(2R,3S,5R)-5-[2-(diethoxyphosphorylamino)-6-oxo-1H-purin-9-yl]-3-hydroxyoxolan-2-yl]methyl diethyl phosphate |
|---|---|
| PubChem CID | 135546258 |
| Molecular Formula | C18H31N5O10P2 |
| Molecular Weight | 539.42 g/mol |
| Exact Mass | 539.15 |
| IUPAC Name | [(2R,3S,5R)-5-[2-(diethoxyphosphorylamino)-6-oxo-1H-purin-9-yl]-3-hydroxyoxolan-2-yl]methyl diethyl phosphate |
| SMILES | CCOP(=O)(Nc1nc2c(ncn2[C@H]2C[C@H](O)[C@@H](COP(=O)(OCC)OCC)O2)c(=O)[nH]1)OCC |
| InChI | InChI=1S/C18H31N5O10P2/c1-5-28-34(26,29-6-2)22-18-20-16-15(17(25)21-18)19-11-23(16)14-9-12(24)13(33-14)10-32-35(27,30-7-3)31-8-4/h11-14,24H,5-10H2,1-4H3,(H2,20,21,22,25,26)/t12-,13+,14+/m0/s1 |
| InChIKey | QGLUQDPNPSPIOQ-BFHYXJOUSA-N |
| XLogP | 2.56 |
| TPSA | 185.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.42 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|