C12H21N6O7P — CID 135505135
azane;[5-[2-(ethylamino)-6-oxo-1H-purin-9-yl]-3-hydroxyoxolan-2-yl]methyl dihydrogen phosphate (PubChem CID 135505135) has the molecular formula C12H21N6O7P and a molecular weight of 392.31 g/mol. Its IUPAC name is azane;[5-[2-(ethylamino)-6-oxo-1H-purin-9-yl]-3-hydroxyoxolan-2-yl]methyl dihydrogen phosphate.
| Compound Name | azane;[5-[2-(ethylamino)-6-oxo-1H-purin-9-yl]-3-hydroxyoxolan-2-yl]methyl dihydrogen phosphate |
|---|---|
| PubChem CID | 135505135 |
| Molecular Formula | C12H21N6O7P |
| Molecular Weight | 392.31 g/mol |
| Exact Mass | 392.12 |
| IUPAC Name | azane;[5-[2-(ethylamino)-6-oxo-1H-purin-9-yl]-3-hydroxyoxolan-2-yl]methyl dihydrogen phosphate |
| SMILES | CCNc1nc2c(ncn2C2CC(O)C(COP(=O)(O)O)O2)c(=O)[nH]1.N |
| InChI | InChI=1S/C12H18N5O7P.H3N/c1-2-13-12-15-10-9(11(19)16-12)14-5-17(10)8-3-6(18)7(24-8)4-23-25(20,21)22;/h5-8,18H,2-4H2,1H3,(H2,20,21,22)(H2,13,15,16,19);1H3 |
| InChIKey | XXQSKKNDAKKPFX-UHFFFAOYSA-N |
| XLogP | -0.53 |
| TPSA | 206.82 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.31 |
| LogP ≤ 5 | -0.53 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|