C10H12FN5O5 — CID 156630904
9-[(2R,3S,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-2-(fluoroamino)-1H-purin-6-one (PubChem CID 156630904) has the molecular formula C10H12FN5O5 and a molecular weight of 301.23 g/mol. Its IUPAC name is 9-[(2R,3S,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-2-(fluoroamino)-1H-purin-6-one.
| Compound Name | 9-[(2R,3S,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-2-(fluoroamino)-1H-purin-6-one |
|---|---|
| PubChem CID | 156630904 |
| Molecular Formula | C10H12FN5O5 |
| Molecular Weight | 301.23 g/mol |
| Exact Mass | 301.08 |
| IUPAC Name | 9-[(2R,3S,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-2-(fluoroamino)-1H-purin-6-one |
| SMILES | O=c1[nH]c(NF)nc2c1ncn2[C@@H]1O[C@H](CO)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C10H12FN5O5/c11-15-10-13-7-4(8(20)14-10)12-2-16(7)9-6(19)5(18)3(1-17)21-9/h2-3,5-6,9,17-19H,1H2,(H2,13,14,15,20)/t3-,5-,6+,9-/m1/s1 |
| InChIKey | NJWWDRWLTDYQDM-FJFJXFQQSA-N |
| XLogP | -1.97 |
| TPSA | 145.52 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.23 |
| LogP ≤ 5 | -1.97 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|