C11H13ClN4O5 — CID 135417307
2-(chloromethyl)-9-[(2S,3S,4R,5S)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-1H-purin-6-one (PubChem CID 135417307) has the molecular formula C11H13ClN4O5 and a molecular weight of 316.70 g/mol. Its IUPAC name is 2-(chloromethyl)-9-[(2S,3S,4R,5S)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-1H-purin-6-one.
| Compound Name | 2-(chloromethyl)-9-[(2S,3S,4R,5S)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-1H-purin-6-one |
|---|---|
| PubChem CID | 135417307 |
| Molecular Formula | C11H13ClN4O5 |
| Molecular Weight | 316.70 g/mol |
| Exact Mass | 316.06 |
| IUPAC Name | 2-(chloromethyl)-9-[(2S,3S,4R,5S)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-1H-purin-6-one |
| SMILES | O=c1[nH]c(CCl)nc2c1ncn2[C@H]1O[C@@H](CO)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C11H13ClN4O5/c12-1-5-14-9-6(10(20)15-5)13-3-16(9)11-8(19)7(18)4(2-17)21-11/h3-4,7-8,11,17-19H,1-2H2,(H,14,15,20)/t4-,7-,8-,11-/m0/s1 |
| InChIKey | HLDZXNJSHABNLR-DPZNGPABSA-N |
| XLogP | -1.53 |
| TPSA | 133.49 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.70 |
| LogP ≤ 5 | -1.53 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|