C12H16N4O7 — CID 135599152
2-(1,2-dihydroxyethyl)-9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-1H-purin-6-one (PubChem CID 135599152) has the molecular formula C12H16N4O7 and a molecular weight of 328.28 g/mol. Its IUPAC name is 2-(1,2-dihydroxyethyl)-9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-1H-purin-6-one.
| Compound Name | 2-(1,2-dihydroxyethyl)-9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-1H-purin-6-one |
|---|---|
| PubChem CID | 135599152 |
| Molecular Formula | C12H16N4O7 |
| Molecular Weight | 328.28 g/mol |
| Exact Mass | 328.10 |
| IUPAC Name | 2-(1,2-dihydroxyethyl)-9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-1H-purin-6-one |
| SMILES | O=c1[nH]c(C(O)CO)nc2c1ncn2[C@@H]1O[C@H](CO)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C12H16N4O7/c17-1-4(19)9-14-10-6(11(22)15-9)13-3-16(10)12-8(21)7(20)5(2-18)23-12/h3-5,7-8,12,17-21H,1-2H2,(H,14,15,22)/t4?,5-,7-,8-,12-/m1/s1 |
| InChIKey | AEWOUGLZUVZUGF-IEJLNPMYSA-N |
| XLogP | -3.24 |
| TPSA | 173.95 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.28 |
| LogP ≤ 5 | -3.24 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |