C23H24N6O8 — CID 135769266
(2R)-N-[9-[(2S,3R,4S,5S)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-6-oxo-1H-purin-2-yl]-2-(1,3-dioxoisoindol-2-yl)-3-methylbutanamide (PubChem CID 135769266) has the molecular formula C23H24N6O8 and a molecular weight of 512.48 g/mol. Its IUPAC name is (2R)-N-[9-[(2S,3R,4S,5S)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-6-oxo-1H-purin-2-yl]-2-(1,3-dioxoisoindol-2-yl)-3-methylbutanamide.
| Compound Name | (2R)-N-[9-[(2S,3R,4S,5S)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-6-oxo-1H-purin-2-yl]-2-(1,3-dioxoisoindol-2-yl)-3-methylbutanamide |
|---|---|
| PubChem CID | 135769266 |
| Molecular Formula | C23H24N6O8 |
| Molecular Weight | 512.48 g/mol |
| Exact Mass | 512.17 |
| IUPAC Name | (2R)-N-[9-[(2S,3R,4S,5S)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-6-oxo-1H-purin-2-yl]-2-(1,3-dioxoisoindol-2-yl)-3-methylbutanamide |
| SMILES | CC(C)[C@H](C(=O)Nc1nc2c(ncn2[C@H]2O[C@@H](CO)[C@@H](O)[C@H]2O)c(=O)[nH]1)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C23H24N6O8/c1-9(2)14(29-20(35)10-5-3-4-6-11(10)21(29)36)19(34)27-23-25-17-13(18(33)26-23)24-8-28(17)22-16(32)15(31)12(7-30)37-22/h3-6,8-9,12,14-16,22,30-32H,7H2,1-2H3,(H2,25,26,27,33,34)/t12-,14+,15+,16+,22-/m0/s1 |
| InChIKey | KQNLYZWFWSWXOV-JHZLKBPESA-N |
| XLogP | -1.01 |
| TPSA | 199.97 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.48 |
| LogP ≤ 5 | -1.01 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|