C12H16N5O13P3 — CID 137022529
[[5-(2-amino-6-oxo-1H-purin-9-yl)-4-ethynyl-3-hydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate (PubChem CID 137022529) has the molecular formula C12H16N5O13P3 and a molecular weight of 531.20 g/mol. Its IUPAC name is [[5-(2-amino-6-oxo-1H-purin-9-yl)-4-ethynyl-3-hydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate.
| Compound Name | [[5-(2-amino-6-oxo-1H-purin-9-yl)-4-ethynyl-3-hydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 137022529 |
| Molecular Formula | C12H16N5O13P3 |
| Molecular Weight | 531.20 g/mol |
| Exact Mass | 531.00 |
| IUPAC Name | [[5-(2-amino-6-oxo-1H-purin-9-yl)-4-ethynyl-3-hydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
| SMILES | C#CC1C(O)C(COP(=O)(O)OP(=O)(O)OP(=O)(O)O)OC1n1cnc2c(=O)[nH]c(N)nc21 |
| InChI | InChI=1S/C12H16N5O13P3/c1-2-5-8(18)6(3-27-32(23,24)30-33(25,26)29-31(20,21)22)28-11(5)17-4-14-7-9(17)15-12(13)16-10(7)19/h1,4-6,8,11,18H,3H2,(H,23,24)(H,25,26)(H2,20,21,22)(H3,13,15,16,19) |
| InChIKey | CXRVKEOGOIDIIQ-UHFFFAOYSA-N |
| XLogP | -1.45 |
| TPSA | 278.87 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.20 |
| LogP ≤ 5 | -1.45 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|