C12H18N5O15P3 — CID 170421052
[2-(2-amino-6-oxo-1H-purin-9-yl)-4-hydroxy-5-[[hydroxy-[hydroxy(phosphonooxy)phosphoryl]oxyphosphoryl]oxymethyl]oxolan-3-yl] acetate (PubChem CID 170421052) has the molecular formula C12H18N5O15P3 and a molecular weight of 565.22 g/mol. Its IUPAC name is [2-(2-amino-6-oxo-1H-purin-9-yl)-4-hydroxy-5-[[hydroxy-[hydroxy(phosphonooxy)phosphoryl]oxyphosphoryl]oxymethyl]oxolan-3-yl] acetate.
| Compound Name | [2-(2-amino-6-oxo-1H-purin-9-yl)-4-hydroxy-5-[[hydroxy-[hydroxy(phosphonooxy)phosphoryl]oxyphosphoryl]oxymethyl]oxolan-3-yl] acetate |
|---|---|
| PubChem CID | 170421052 |
| Molecular Formula | C12H18N5O15P3 |
| Molecular Weight | 565.22 g/mol |
| Exact Mass | 565.00 |
| IUPAC Name | [2-(2-amino-6-oxo-1H-purin-9-yl)-4-hydroxy-5-[[hydroxy-[hydroxy(phosphonooxy)phosphoryl]oxyphosphoryl]oxymethyl]oxolan-3-yl] acetate |
| SMILES | CC(=O)OC1C(O)C(COP(=O)(O)OP(=O)(O)OP(=O)(O)O)OC1n1cnc2c(=O)[nH]c(N)nc21 |
| InChI | InChI=1S/C12H18N5O15P3/c1-4(18)29-8-7(19)5(2-28-34(24,25)32-35(26,27)31-33(21,22)23)30-11(8)17-3-14-6-9(17)15-12(13)16-10(6)20/h3,5,7-8,11,19H,2H2,1H3,(H,24,25)(H,26,27)(H2,21,22,23)(H3,13,15,16,20) |
| InChIKey | SJZPTKMEDCVFCF-UHFFFAOYSA-N |
| XLogP | -1.76 |
| TPSA | 305.17 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.22 |
| LogP ≤ 5 | -1.76 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|