C17H20ClN6O15P3 — CID 172873666
[(2R,3R,4R,5R)-2-(2-amino-6-oxo-1H-purin-9-yl)-4-hydroxy-5-[[hydroxy-[hydroxy(phosphonooxy)phosphoryl]oxyphosphoryl]oxymethyl]oxolan-3-yl] 2-amino-5-chlorobenzoate (PubChem CID 172873666) has the molecular formula C17H20ClN6O15P3 and a molecular weight of 676.75 g/mol. Its IUPAC name is [(2R,3R,4R,5R)-2-(2-amino-6-oxo-1H-purin-9-yl)-4-hydroxy-5-[[hydroxy-[hydroxy(phosphonooxy)phosphoryl]oxyphosphoryl]oxymethyl]oxolan-3-yl] 2-amino-5-chlorobenzoate.
| Compound Name | [(2R,3R,4R,5R)-2-(2-amino-6-oxo-1H-purin-9-yl)-4-hydroxy-5-[[hydroxy-[hydroxy(phosphonooxy)phosphoryl]oxyphosphoryl]oxymethyl]oxolan-3-yl] 2-amino-5-chlorobenzoate |
|---|---|
| PubChem CID | 172873666 |
| Molecular Formula | C17H20ClN6O15P3 |
| Molecular Weight | 676.75 g/mol |
| Exact Mass | 675.99 |
| IUPAC Name | [(2R,3R,4R,5R)-2-(2-amino-6-oxo-1H-purin-9-yl)-4-hydroxy-5-[[hydroxy-[hydroxy(phosphonooxy)phosphoryl]oxyphosphoryl]oxymethyl]oxolan-3-yl] 2-amino-5-chlorobenzoate |
| SMILES | Nc1nc2c(ncn2[C@@H]2O[C@H](COP(=O)(O)OP(=O)(O)OP(=O)(O)O)[C@@H](O)[C@H]2OC(=O)c2cc(Cl)ccc2N)c(=O)[nH]1 |
| InChI | InChI=1S/C17H20ClN6O15P3/c18-6-1-2-8(19)7(3-6)16(27)37-12-11(25)9(4-35-41(31,32)39-42(33,34)38-40(28,29)30)36-15(12)24-5-21-10-13(24)22-17(20)23-14(10)26/h1-3,5,9,11-12,15,25H,4,19H2,(H,31,32)(H,33,34)(H2,28,29,30)(H3,20,22,23,26)/t9-,11-,12-,15-/m1/s1 |
| InChIKey | RYUSPBGDQHPCRE-SDBHATRESA-N |
| XLogP | -0.24 |
| TPSA | 331.19 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 676.75 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|