C17H19BrN5O15P3 — CID 172873299
[(2R,3R,4R,5R)-4-hydroxy-5-[[hydroxy-[hydroxy(phosphonooxy)phosphoryl]oxyphosphoryl]oxymethyl]-2-(6-oxo-1H-purin-9-yl)oxolan-3-yl] 2-amino-5-bromobenzoate (PubChem CID 172873299) has the molecular formula C17H19BrN5O15P3 and a molecular weight of 706.18 g/mol. Its IUPAC name is [(2R,3R,4R,5R)-4-hydroxy-5-[[hydroxy-[hydroxy(phosphonooxy)phosphoryl]oxyphosphoryl]oxymethyl]-2-(6-oxo-1H-purin-9-yl)oxolan-3-yl] 2-amino-5-bromobenzoate.
| Compound Name | [(2R,3R,4R,5R)-4-hydroxy-5-[[hydroxy-[hydroxy(phosphonooxy)phosphoryl]oxyphosphoryl]oxymethyl]-2-(6-oxo-1H-purin-9-yl)oxolan-3-yl] 2-amino-5-bromobenzoate |
|---|---|
| PubChem CID | 172873299 |
| Molecular Formula | C17H19BrN5O15P3 |
| Molecular Weight | 706.18 g/mol |
| Exact Mass | 704.93 |
| IUPAC Name | [(2R,3R,4R,5R)-4-hydroxy-5-[[hydroxy-[hydroxy(phosphonooxy)phosphoryl]oxyphosphoryl]oxymethyl]-2-(6-oxo-1H-purin-9-yl)oxolan-3-yl] 2-amino-5-bromobenzoate |
| SMILES | Nc1ccc(Br)cc1C(=O)O[C@@H]1[C@H](O)[C@@H](COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O[C@H]1n1cnc2c(=O)[nH]cnc21 |
| InChI | InChI=1S/C17H19BrN5O15P3/c18-7-1-2-9(19)8(3-7)17(26)36-13-12(24)10(4-34-40(30,31)38-41(32,33)37-39(27,28)29)35-16(13)23-6-22-11-14(23)20-5-21-15(11)25/h1-3,5-6,10,12-13,16,24H,4,19H2,(H,30,31)(H,32,33)(H,20,21,25)(H2,27,28,29)/t10-,12-,13-,16-/m1/s1 |
| InChIKey | GOPCYZPAIPGCOR-XNIJJKJLSA-N |
| XLogP | 0.29 |
| TPSA | 305.17 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 706.18 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|