C13H19N4O14P3 — CID 174154046
[(2R,4S,5R)-2-(7-aminoimidazo[4,5-b]pyridin-3-yl)-4-hydroxy-5-[[hydroxy-[hydroxy(phosphonooxy)phosphoryl]oxyphosphoryl]oxymethyl]oxolan-3-yl] acetate (PubChem CID 174154046) has the molecular formula C13H19N4O14P3 and a molecular weight of 548.23 g/mol. Its IUPAC name is [(2R,4S,5R)-2-(7-aminoimidazo[4,5-b]pyridin-3-yl)-4-hydroxy-5-[[hydroxy-[hydroxy(phosphonooxy)phosphoryl]oxyphosphoryl]oxymethyl]oxolan-3-yl] acetate.
| Compound Name | [(2R,4S,5R)-2-(7-aminoimidazo[4,5-b]pyridin-3-yl)-4-hydroxy-5-[[hydroxy-[hydroxy(phosphonooxy)phosphoryl]oxyphosphoryl]oxymethyl]oxolan-3-yl] acetate |
|---|---|
| PubChem CID | 174154046 |
| Molecular Formula | C13H19N4O14P3 |
| Molecular Weight | 548.23 g/mol |
| Exact Mass | 548.01 |
| IUPAC Name | [(2R,4S,5R)-2-(7-aminoimidazo[4,5-b]pyridin-3-yl)-4-hydroxy-5-[[hydroxy-[hydroxy(phosphonooxy)phosphoryl]oxyphosphoryl]oxymethyl]oxolan-3-yl] acetate |
| SMILES | CC(=O)OC1[C@@H](O)[C@@H](COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O[C@H]1n1cnc2c(N)ccnc21 |
| InChI | InChI=1S/C13H19N4O14P3/c1-6(18)28-11-10(19)8(4-27-33(23,24)31-34(25,26)30-32(20,21)22)29-13(11)17-5-16-9-7(14)2-3-15-12(9)17/h2-3,5,8,10-11,13,19H,4H2,1H3,(H2,14,15)(H,23,24)(H,25,26)(H2,20,21,22)/t8-,10+,11?,13-/m1/s1 |
| InChIKey | ADHZGTSEJQRQRT-FSWKUEMBSA-N |
| XLogP | -0.45 |
| TPSA | 272.31 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.23 |
| LogP ≤ 5 | -0.45 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|