C16H24ClN5O10P2 — CID 158106720
[amino-(5-chloro-4-oxopentoxy)phosphoryl] [(2R,3S,4R,5R)-5-(7-aminoimidazo[4,5-b]pyridin-3-yl)-3,4-dihydroxyoxolan-2-yl]methyl hydrogen phosphate (PubChem CID 158106720) has the molecular formula C16H24ClN5O10P2 and a molecular weight of 543.79 g/mol. Its IUPAC name is [amino-(5-chloro-4-oxopentoxy)phosphoryl] [(2R,3S,4R,5R)-5-(7-aminoimidazo[4,5-b]pyridin-3-yl)-3,4-dihydroxyoxolan-2-yl]methyl hydrogen phosphate.
| Compound Name | [amino-(5-chloro-4-oxopentoxy)phosphoryl] [(2R,3S,4R,5R)-5-(7-aminoimidazo[4,5-b]pyridin-3-yl)-3,4-dihydroxyoxolan-2-yl]methyl hydrogen phosphate |
|---|---|
| PubChem CID | 158106720 |
| Molecular Formula | C16H24ClN5O10P2 |
| Molecular Weight | 543.79 g/mol |
| Exact Mass | 543.07 |
| IUPAC Name | [amino-(5-chloro-4-oxopentoxy)phosphoryl] [(2R,3S,4R,5R)-5-(7-aminoimidazo[4,5-b]pyridin-3-yl)-3,4-dihydroxyoxolan-2-yl]methyl hydrogen phosphate |
| SMILES | Nc1ccnc2c1ncn2[C@@H]1O[C@H](COP(=O)(O)OP(N)(=O)OCCCC(=O)CCl)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C16H24ClN5O10P2/c17-6-9(23)2-1-5-29-33(19,26)32-34(27,28)30-7-11-13(24)14(25)16(31-11)22-8-21-12-10(18)3-4-20-15(12)22/h3-4,8,11,13-14,16,24-25H,1-2,5-7H2,(H2,18,20)(H2,19,26)(H,27,28)/t11-,13-,14-,16-,33?/m1/s1 |
| InChIKey | FRBDWVHACJWXST-YRBZUNAXSA-N |
| XLogP | 0.44 |
| TPSA | 231.57 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.79 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|