C17H25ClN5O9P — CID 159065042
[(2R,3S,4R,5R)-5-(2-amino-6-oxo-1H-purin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl (7-chloro-6-oxoheptyl) hydrogen phosphate (PubChem CID 159065042) has the molecular formula C17H25ClN5O9P and a molecular weight of 509.84 g/mol. Its IUPAC name is [(2R,3S,4R,5R)-5-(2-amino-6-oxo-1H-purin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl (7-chloro-6-oxoheptyl) hydrogen phosphate.
| Compound Name | [(2R,3S,4R,5R)-5-(2-amino-6-oxo-1H-purin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl (7-chloro-6-oxoheptyl) hydrogen phosphate |
|---|---|
| PubChem CID | 159065042 |
| Molecular Formula | C17H25ClN5O9P |
| Molecular Weight | 509.84 g/mol |
| Exact Mass | 509.11 |
| IUPAC Name | [(2R,3S,4R,5R)-5-(2-amino-6-oxo-1H-purin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl (7-chloro-6-oxoheptyl) hydrogen phosphate |
| SMILES | Nc1nc2c(ncn2[C@@H]2O[C@H](COP(=O)(O)OCCCCCC(=O)CCl)[C@@H](O)[C@H]2O)c(=O)[nH]1 |
| InChI | InChI=1S/C17H25ClN5O9P/c18-6-9(24)4-2-1-3-5-30-33(28,29)31-7-10-12(25)13(26)16(32-10)23-8-20-11-14(23)21-17(19)22-15(11)27/h8,10,12-13,16,25-26H,1-7H2,(H,28,29)(H3,19,21,22,27)/t10-,12-,13-,16-/m1/s1 |
| InChIKey | JYYIGERIFUCXQT-XNIJJKJLSA-N |
| XLogP | -0.18 |
| TPSA | 212.11 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.84 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|