C12H19N6O8P — CID 136994260
2-aminoethyl [(2R,3S,4R,5R)-5-(2-amino-6-oxo-1H-purin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl hydrogen phosphate (PubChem CID 136994260) has the molecular formula C12H19N6O8P and a molecular weight of 406.29 g/mol. Its IUPAC name is 2-aminoethyl [(2R,3S,4R,5R)-5-(2-amino-6-oxo-1H-purin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl hydrogen phosphate.
| Compound Name | 2-aminoethyl [(2R,3S,4R,5R)-5-(2-amino-6-oxo-1H-purin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl hydrogen phosphate |
|---|---|
| PubChem CID | 136994260 |
| Molecular Formula | C12H19N6O8P |
| Molecular Weight | 406.29 g/mol |
| Exact Mass | 406.10 |
| IUPAC Name | 2-aminoethyl [(2R,3S,4R,5R)-5-(2-amino-6-oxo-1H-purin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl hydrogen phosphate |
| SMILES | NCCOP(=O)(O)OC[C@H]1O[C@@H](n2cnc3c(=O)[nH]c(N)nc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C12H19N6O8P/c13-1-2-24-27(22,23)25-3-5-7(19)8(20)11(26-5)18-4-15-6-9(18)16-12(14)17-10(6)21/h4-5,7-8,11,19-20H,1-3,13H2,(H,22,23)(H3,14,16,17,21)/t5-,7-,8-,11-/m1/s1 |
| InChIKey | HCQLDQVLPQFZOR-IOSLPCCCSA-N |
| XLogP | -2.59 |
| TPSA | 221.06 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.29 |
| LogP ≤ 5 | -2.59 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|