C15H25N5O13P2 — CID 139538585
2-[2-[[(2R,3S,4R,5R)-5-(2-amino-6-oxo-1H-purin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl]oxyethoxy]ethyl methyl hydrogen phosphate (PubChem CID 139538585) has the molecular formula C15H25N5O13P2 and a molecular weight of 545.34 g/mol. Its IUPAC name is 2-[2-[[(2R,3S,4R,5R)-5-(2-amino-6-oxo-1H-purin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl]oxyethoxy]ethyl methyl hydrogen phosphate.
| Compound Name | 2-[2-[[(2R,3S,4R,5R)-5-(2-amino-6-oxo-1H-purin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl]oxyethoxy]ethyl methyl hydrogen phosphate |
|---|---|
| PubChem CID | 139538585 |
| Molecular Formula | C15H25N5O13P2 |
| Molecular Weight | 545.34 g/mol |
| Exact Mass | 545.09 |
| IUPAC Name | 2-[2-[[(2R,3S,4R,5R)-5-(2-amino-6-oxo-1H-purin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl]oxyethoxy]ethyl methyl hydrogen phosphate |
| SMILES | COP(=O)(O)OCCOCCOP(=O)(O)OC[C@H]1O[C@@H](n2cnc3c(=O)[nH]c(N)nc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C15H25N5O13P2/c1-28-34(24,25)30-4-2-29-3-5-31-35(26,27)32-6-8-10(21)11(22)14(33-8)20-7-17-9-12(20)18-15(16)19-13(9)23/h7-8,10-11,14,21-22H,2-6H2,1H3,(H,24,25)(H,26,27)(H3,16,18,19,23)/t8-,10-,11-,14-/m1/s1 |
| InChIKey | OVWRNFHCWSOEFN-IDTAVKCVSA-N |
| XLogP | -1.77 |
| TPSA | 260.03 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.34 |
| LogP ≤ 5 | -1.77 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|