C17H21N6O15P3 — CID 172874567
[2-(2-amino-6-oxo-1H-purin-9-yl)-4-hydroxy-5-[[hydroxy-[hydroxy(phosphonooxy)phosphoryl]oxyphosphoryl]oxymethyl]oxolan-3-yl] 2-aminobenzoate (PubChem CID 172874567) has the molecular formula C17H21N6O15P3 and a molecular weight of 642.30 g/mol. Its IUPAC name is [2-(2-amino-6-oxo-1H-purin-9-yl)-4-hydroxy-5-[[hydroxy-[hydroxy(phosphonooxy)phosphoryl]oxyphosphoryl]oxymethyl]oxolan-3-yl] 2-aminobenzoate.
| Compound Name | [2-(2-amino-6-oxo-1H-purin-9-yl)-4-hydroxy-5-[[hydroxy-[hydroxy(phosphonooxy)phosphoryl]oxyphosphoryl]oxymethyl]oxolan-3-yl] 2-aminobenzoate |
|---|---|
| PubChem CID | 172874567 |
| Molecular Formula | C17H21N6O15P3 |
| Molecular Weight | 642.30 g/mol |
| Exact Mass | 642.03 |
| IUPAC Name | [2-(2-amino-6-oxo-1H-purin-9-yl)-4-hydroxy-5-[[hydroxy-[hydroxy(phosphonooxy)phosphoryl]oxyphosphoryl]oxymethyl]oxolan-3-yl] 2-aminobenzoate |
| SMILES | Nc1nc2c(ncn2C2OC(COP(=O)(O)OP(=O)(O)OP(=O)(O)O)C(O)C2OC(=O)c2ccccc2N)c(=O)[nH]1 |
| InChI | InChI=1S/C17H21N6O15P3/c18-8-4-2-1-3-7(8)16(26)36-12-11(24)9(5-34-40(30,31)38-41(32,33)37-39(27,28)29)35-15(12)23-6-20-10-13(23)21-17(19)22-14(10)25/h1-4,6,9,11-12,15,24H,5,18H2,(H,30,31)(H,32,33)(H2,27,28,29)(H3,19,21,22,25) |
| InChIKey | SRQXCBVMVLZJMJ-UHFFFAOYSA-N |
| XLogP | -0.89 |
| TPSA | 331.19 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.30 |
| LogP ≤ 5 | -0.89 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|