C17H22N5O14P3 — CID 172873669
[[5-(2-amino-6-oxo-1H-purin-9-yl)-4-hydroxy-3-phenylmethoxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate (PubChem CID 172873669) has the molecular formula C17H22N5O14P3 and a molecular weight of 613.31 g/mol. Its IUPAC name is [[5-(2-amino-6-oxo-1H-purin-9-yl)-4-hydroxy-3-phenylmethoxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate.
| Compound Name | [[5-(2-amino-6-oxo-1H-purin-9-yl)-4-hydroxy-3-phenylmethoxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 172873669 |
| Molecular Formula | C17H22N5O14P3 |
| Molecular Weight | 613.31 g/mol |
| Exact Mass | 613.04 |
| IUPAC Name | [[5-(2-amino-6-oxo-1H-purin-9-yl)-4-hydroxy-3-phenylmethoxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
| SMILES | Nc1nc2c(ncn2C2OC(COP(=O)(O)OP(=O)(O)OP(=O)(O)O)C(OCc3ccccc3)C2O)c(=O)[nH]1 |
| InChI | InChI=1S/C17H22N5O14P3/c18-17-20-14-11(15(24)21-17)19-8-22(14)16-12(23)13(32-6-9-4-2-1-3-5-9)10(34-16)7-33-38(28,29)36-39(30,31)35-37(25,26)27/h1-5,8,10,12-13,16,23H,6-7H2,(H,28,29)(H,30,31)(H2,25,26,27)(H3,18,20,21,24) |
| InChIKey | GKNJRRUERJECKC-UHFFFAOYSA-N |
| XLogP | -0.11 |
| TPSA | 288.10 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.31 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|