C11H15F3N5O14P3 — CID 146192885
[[(2R,3S,4R,5R)-5-(2-amino-6-oxo-1H-purin-9-yl)-3-hydroxy-4-(trifluoromethoxy)oxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate (PubChem CID 146192885) has the molecular formula C11H15F3N5O14P3 and a molecular weight of 591.18 g/mol. Its IUPAC name is [[(2R,3S,4R,5R)-5-(2-amino-6-oxo-1H-purin-9-yl)-3-hydroxy-4-(trifluoromethoxy)oxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate.
| Compound Name | [[(2R,3S,4R,5R)-5-(2-amino-6-oxo-1H-purin-9-yl)-3-hydroxy-4-(trifluoromethoxy)oxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 146192885 |
| Molecular Formula | C11H15F3N5O14P3 |
| Molecular Weight | 591.18 g/mol |
| Exact Mass | 590.98 |
| IUPAC Name | [[(2R,3S,4R,5R)-5-(2-amino-6-oxo-1H-purin-9-yl)-3-hydroxy-4-(trifluoromethoxy)oxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
| SMILES | Nc1nc2c(ncn2[C@@H]2O[C@H](COP(=O)(O)OP(=O)(O)OP(=O)(O)O)[C@H](O)[C@H]2OC(F)(F)F)c(=O)[nH]1 |
| InChI | InChI=1S/C11H15F3N5O14P3/c12-11(13,14)31-6-5(20)3(1-29-35(25,26)33-36(27,28)32-34(22,23)24)30-9(6)19-2-16-4-7(19)17-10(15)18-8(4)21/h2-3,5-6,9,20H,1H2,(H,25,26)(H,27,28)(H2,22,23,24)(H3,15,17,18,21)/t3-,5+,6-,9-/m1/s1 |
| InChIKey | BVMWFFDGVDFKCN-FTWQFJAYSA-N |
| XLogP | -0.79 |
| TPSA | 288.10 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.18 |
| LogP ≤ 5 | -0.79 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|