C18H21N6O9P — CID 163975717
[(2R,3R,4R,5R)-2-(2-amino-6-oxo-1H-purin-9-yl)-4-hydroxy-5-(phosphonooxymethyl)oxolan-3-yl] 2-(methylamino)benzoate (PubChem CID 163975717) has the molecular formula C18H21N6O9P and a molecular weight of 496.37 g/mol. Its IUPAC name is [(2R,3R,4R,5R)-2-(2-amino-6-oxo-1H-purin-9-yl)-4-hydroxy-5-(phosphonooxymethyl)oxolan-3-yl] 2-(methylamino)benzoate.
| Compound Name | [(2R,3R,4R,5R)-2-(2-amino-6-oxo-1H-purin-9-yl)-4-hydroxy-5-(phosphonooxymethyl)oxolan-3-yl] 2-(methylamino)benzoate |
|---|---|
| PubChem CID | 163975717 |
| Molecular Formula | C18H21N6O9P |
| Molecular Weight | 496.37 g/mol |
| Exact Mass | 496.11 |
| IUPAC Name | [(2R,3R,4R,5R)-2-(2-amino-6-oxo-1H-purin-9-yl)-4-hydroxy-5-(phosphonooxymethyl)oxolan-3-yl] 2-(methylamino)benzoate |
| SMILES | CNc1ccccc1C(=O)O[C@@H]1[C@H](O)[C@@H](COP(=O)(O)O)O[C@H]1n1cnc2c(=O)[nH]c(N)nc21 |
| InChI | InChI=1S/C18H21N6O9P/c1-20-9-5-3-2-4-8(9)17(27)33-13-12(25)10(6-31-34(28,29)30)32-16(13)24-7-21-11-14(24)22-18(19)23-15(11)26/h2-5,7,10,12-13,16,20,25H,6H2,1H3,(H2,28,29,30)(H3,19,22,23,26)/t10-,12-,13-,16-/m1/s1 |
| InChIKey | STYIAMBUPHSXFX-XNIJJKJLSA-N |
| XLogP | -0.66 |
| TPSA | 224.14 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.37 |
| LogP ≤ 5 | -0.66 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|