C19H26N8O15P2 — CID 136872470
[(2R,3R,4R,5R)-2-(2-amino-6-oxo-1H-purin-9-yl)-4-hydroxy-5-(phosphonooxymethyl)oxolan-3-yl] [(2R,3S,4R,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl hydrogen phosphate (PubChem CID 136872470) has the molecular formula C19H26N8O15P2 and a molecular weight of 668.41 g/mol. Its IUPAC name is [(2R,3R,4R,5R)-2-(2-amino-6-oxo-1H-purin-9-yl)-4-hydroxy-5-(phosphonooxymethyl)oxolan-3-yl] [(2R,3S,4R,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl hydrogen phosphate.
| Compound Name | [(2R,3R,4R,5R)-2-(2-amino-6-oxo-1H-purin-9-yl)-4-hydroxy-5-(phosphonooxymethyl)oxolan-3-yl] [(2R,3S,4R,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl hydrogen phosphate |
|---|---|
| PubChem CID | 136872470 |
| Molecular Formula | C19H26N8O15P2 |
| Molecular Weight | 668.41 g/mol |
| Exact Mass | 668.10 |
| IUPAC Name | [(2R,3R,4R,5R)-2-(2-amino-6-oxo-1H-purin-9-yl)-4-hydroxy-5-(phosphonooxymethyl)oxolan-3-yl] [(2R,3S,4R,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl hydrogen phosphate |
| SMILES | Nc1ccn([C@@H]2O[C@H](COP(=O)(O)O[C@@H]3[C@H](O)[C@@H](COP(=O)(O)O)O[C@H]3n3cnc4c(=O)[nH]c(N)nc43)[C@@H](O)[C@H]2O)c(=O)n1 |
| InChI | InChI=1S/C19H26N8O15P2/c20-8-1-2-26(19(32)23-8)16-12(30)10(28)6(40-16)4-39-44(36,37)42-13-11(29)7(3-38-43(33,34)35)41-17(13)27-5-22-9-14(27)24-18(21)25-15(9)31/h1-2,5-7,10-13,16-17,28-30H,3-4H2,(H,36,37)(H2,20,23,32)(H2,33,34,35)(H3,21,24,25,31)/t6-,7-,10-,11-,12-,13-,16-,17-/m1/s1 |
| InChIKey | BDZCMSUPDUQCDB-VMIOUTBZSA-N |
| XLogP | -3.97 |
| TPSA | 352.17 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 19 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 668.41 |
| LogP ≤ 5 | -3.97 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 19 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|