C17H29N7O12P2 — CID 172874391
[2-(2-amino-6-oxo-1H-purin-9-yl)-4-hydroxy-5-[[hydroxy(phosphonooxy)phosphoryl]oxymethyl]oxolan-3-yl] N-(6-aminohexyl)carbamate (PubChem CID 172874391) has the molecular formula C17H29N7O12P2 and a molecular weight of 585.40 g/mol. Its IUPAC name is [2-(2-amino-6-oxo-1H-purin-9-yl)-4-hydroxy-5-[[hydroxy(phosphonooxy)phosphoryl]oxymethyl]oxolan-3-yl] N-(6-aminohexyl)carbamate.
| Compound Name | [2-(2-amino-6-oxo-1H-purin-9-yl)-4-hydroxy-5-[[hydroxy(phosphonooxy)phosphoryl]oxymethyl]oxolan-3-yl] N-(6-aminohexyl)carbamate |
|---|---|
| PubChem CID | 172874391 |
| Molecular Formula | C17H29N7O12P2 |
| Molecular Weight | 585.40 g/mol |
| Exact Mass | 585.13 |
| IUPAC Name | [2-(2-amino-6-oxo-1H-purin-9-yl)-4-hydroxy-5-[[hydroxy(phosphonooxy)phosphoryl]oxymethyl]oxolan-3-yl] N-(6-aminohexyl)carbamate |
| SMILES | NCCCCCCNC(=O)OC1C(O)C(COP(=O)(O)OP(=O)(O)O)OC1n1cnc2c(=O)[nH]c(N)nc21 |
| InChI | InChI=1S/C17H29N7O12P2/c18-5-3-1-2-4-6-20-17(27)35-12-11(25)9(7-33-38(31,32)36-37(28,29)30)34-15(12)24-8-21-10-13(24)22-16(19)23-14(10)26/h8-9,11-12,15,25H,1-7,18H2,(H,20,27)(H,31,32)(H2,28,29,30)(H3,19,22,23,26) |
| InChIKey | YUKRDJLTWJBHRL-UHFFFAOYSA-N |
| XLogP | -1.20 |
| TPSA | 296.69 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.40 |
| LogP ≤ 5 | -1.20 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|