C10H10Cl2N4O3 — CID 88905234
(2R,3S)-5-(2,6-dichloropurin-7-yl)-2-(hydroxymethyl)oxolan-3-ol (PubChem CID 88905234) has the molecular formula C10H10Cl2N4O3 and a molecular weight of 305.12 g/mol. Its IUPAC name is (2R,3S)-5-(2,6-dichloropurin-7-yl)-2-(hydroxymethyl)oxolan-3-ol.
| Compound Name | (2R,3S)-5-(2,6-dichloropurin-7-yl)-2-(hydroxymethyl)oxolan-3-ol |
|---|---|
| PubChem CID | 88905234 |
| Molecular Formula | C10H10Cl2N4O3 |
| Molecular Weight | 305.12 g/mol |
| Exact Mass | 304.01 |
| IUPAC Name | (2R,3S)-5-(2,6-dichloropurin-7-yl)-2-(hydroxymethyl)oxolan-3-ol |
| SMILES | OC[C@H]1OC(n2cnc3nc(Cl)nc(Cl)c32)C[C@@H]1O |
| InChI | InChI=1S/C10H10Cl2N4O3/c11-8-7-9(15-10(12)14-8)13-3-16(7)6-1-4(18)5(2-17)19-6/h3-6,17-18H,1-2H2/t4-,5+,6?/m0/s1 |
| InChIKey | OHXVWDUBRVVBRZ-YRZWDFBDSA-N |
| XLogP | 0.77 |
| TPSA | 93.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.12 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |