C10H10Cl2N4O3 — CID 87921447
(2S,3R,5R)-5-(2,8-dichloropurin-9-yl)-2-(hydroxymethyl)oxolan-3-ol (PubChem CID 87921447) has the molecular formula C10H10Cl2N4O3 and a molecular weight of 305.12 g/mol. Its IUPAC name is (2S,3R,5R)-5-(2,8-dichloropurin-9-yl)-2-(hydroxymethyl)oxolan-3-ol.
| Compound Name | (2S,3R,5R)-5-(2,8-dichloropurin-9-yl)-2-(hydroxymethyl)oxolan-3-ol |
|---|---|
| PubChem CID | 87921447 |
| Molecular Formula | C10H10Cl2N4O3 |
| Molecular Weight | 305.12 g/mol |
| Exact Mass | 304.01 |
| IUPAC Name | (2S,3R,5R)-5-(2,8-dichloropurin-9-yl)-2-(hydroxymethyl)oxolan-3-ol |
| SMILES | OC[C@@H]1O[C@@H](n2c(Cl)nc3cnc(Cl)nc32)C[C@H]1O |
| InChI | InChI=1S/C10H10Cl2N4O3/c11-9-13-2-4-8(15-9)16(10(12)14-4)7-1-5(18)6(3-17)19-7/h2,5-7,17-18H,1,3H2/t5-,6+,7-/m1/s1 |
| InChIKey | GZRGBUJUHRVLLY-DSYKOEDSSA-N |
| XLogP | 0.77 |
| TPSA | 93.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.12 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |