C17H17ClN4O3S — CID 176792273
(2R,5R)-5-(6-benzylsulfanyl-2-chloropurin-9-yl)-2-(hydroxymethyl)oxolan-3-ol (PubChem CID 176792273) has the molecular formula C17H17ClN4O3S and a molecular weight of 392.87 g/mol. Its IUPAC name is (2R,5R)-5-(6-benzylsulfanyl-2-chloropurin-9-yl)-2-(hydroxymethyl)oxolan-3-ol.
| Compound Name | (2R,5R)-5-(6-benzylsulfanyl-2-chloropurin-9-yl)-2-(hydroxymethyl)oxolan-3-ol |
|---|---|
| PubChem CID | 176792273 |
| Molecular Formula | C17H17ClN4O3S |
| Molecular Weight | 392.87 g/mol |
| Exact Mass | 392.07 |
| IUPAC Name | (2R,5R)-5-(6-benzylsulfanyl-2-chloropurin-9-yl)-2-(hydroxymethyl)oxolan-3-ol |
| SMILES | OC[C@H]1O[C@@H](n2cnc3c(SCc4ccccc4)nc(Cl)nc32)CC1O |
| InChI | InChI=1S/C17H17ClN4O3S/c18-17-20-15-14(16(21-17)26-8-10-4-2-1-3-5-10)19-9-22(15)13-6-11(24)12(7-23)25-13/h1-5,9,11-13,23-24H,6-8H2/t11?,12-,13-/m1/s1 |
| InChIKey | PCPIJADSAXPRMZ-VFRRUGBOSA-N |
| XLogP | 2.41 |
| TPSA | 93.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.87 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |