C19H21N5O5 — CID 136778020
(6S,8R)-8-hydroxy-3-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-6-phenyl-5,6,7,8-tetrahydropyrimido[1,2-a]purin-10-one (PubChem CID 136778020) has the molecular formula C19H21N5O5 and a molecular weight of 399.41 g/mol. Its IUPAC name is (6S,8R)-8-hydroxy-3-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-6-phenyl-5,6,7,8-tetrahydropyrimido[1,2-a]purin-10-one.
| Compound Name | (6S,8R)-8-hydroxy-3-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-6-phenyl-5,6,7,8-tetrahydropyrimido[1,2-a]purin-10-one |
|---|---|
| PubChem CID | 136778020 |
| Molecular Formula | C19H21N5O5 |
| Molecular Weight | 399.41 g/mol |
| Exact Mass | 399.15 |
| IUPAC Name | (6S,8R)-8-hydroxy-3-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-6-phenyl-5,6,7,8-tetrahydropyrimido[1,2-a]purin-10-one |
| SMILES | O=c1c2ncn([C@H]3C[C@H](O)[C@@H](CO)O3)c2nc2n1[C@H](O)C[C@@H](c1ccccc1)N2 |
| InChI | InChI=1S/C19H21N5O5/c25-8-13-12(26)7-15(29-13)23-9-20-16-17(23)22-19-21-11(10-4-2-1-3-5-10)6-14(27)24(19)18(16)28/h1-5,9,11-15,25-27H,6-8H2,(H,21,22)/t11-,12-,13+,14+,15+/m0/s1 |
| InChIKey | XFIGAFSZASMHPC-VQJWOFKYSA-N |
| XLogP | 0.28 |
| TPSA | 134.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.41 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |