C16H15N5O6 — CID 10761867
9-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-1-(2-nitrophenyl)purin-6-one (PubChem CID 10761867) has the molecular formula C16H15N5O6 and a molecular weight of 373.33 g/mol. Its IUPAC name is 9-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-1-(2-nitrophenyl)purin-6-one.
| Compound Name | 9-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-1-(2-nitrophenyl)purin-6-one |
|---|---|
| PubChem CID | 10761867 |
| Molecular Formula | C16H15N5O6 |
| Molecular Weight | 373.33 g/mol |
| Exact Mass | 373.10 |
| IUPAC Name | 9-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-1-(2-nitrophenyl)purin-6-one |
| SMILES | O=c1c2ncn([C@H]3C[C@H](O)[C@@H](CO)O3)c2ncn1-c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C16H15N5O6/c22-6-12-11(23)5-13(27-12)20-7-17-14-15(20)18-8-19(16(14)24)9-3-1-2-4-10(9)21(25)26/h1-4,7-8,11-13,22-23H,5-6H2/t11-,12+,13+/m0/s1 |
| InChIKey | JRBMRYPNTAKHKG-YNEHKIRRSA-N |
| XLogP | 0.13 |
| TPSA | 145.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.33 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|