C10H11ClN4O3 — CID 10588282
(2R,3S,5R)-5-(6-chloropurin-9-yl)-2-(hydroxymethyl)oxolan-3-ol (PubChem CID 10588282) has the molecular formula C10H11ClN4O3 and a molecular weight of 272.66 g/mol. Its IUPAC name is (2R,3S,5R)-5-(6-chloropurin-9-yl)-2-(hydroxymethyl)oxolan-3-ol.
| Compound Name | (2R,3S,5R)-5-(6-chloropurin-9-yl)-2-(hydroxymethyl)oxolan-3-ol |
|---|---|
| PubChem CID | 10588282 |
| Molecular Formula | C10H11ClN4O3 |
| Molecular Weight | 272.66 g/mol |
| Exact Mass | 272.05 |
| IUPAC Name | (2R,3S,5R)-5-(6-chloropurin-9-yl)-2-(hydroxymethyl)oxolan-3-ol |
| SMILES | OC[C@H]1O[C@@H](n2cnc3c(Cl)[15n]c[15n]c32)C[C@@H]1O |
| InChI | InChI=1S/C10H11ClN4O3/c11-9-8-10(13-3-12-9)15(4-14-8)7-1-5(17)6(2-16)18-7/h3-7,16-17H,1-2H2/t5-,6+,7+/m0/s1/i12+1,13+1 |
| InChIKey | PGEULCIODBNODW-URYSKQSUSA-N |
| XLogP | 0.12 |
| TPSA | 93.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.66 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |