C10H11ClN4O2 — CID 10706154
(2R,3S,5R)-5-(6-chloropurin-9-yl)-2-methyloxolan-3-ol (PubChem CID 10706154) has the molecular formula C10H11ClN4O2 and a molecular weight of 254.68 g/mol. Its IUPAC name is (2R,3S,5R)-5-(6-chloropurin-9-yl)-2-methyloxolan-3-ol.
| Compound Name | (2R,3S,5R)-5-(6-chloropurin-9-yl)-2-methyloxolan-3-ol |
|---|---|
| PubChem CID | 10706154 |
| Molecular Formula | C10H11ClN4O2 |
| Molecular Weight | 254.68 g/mol |
| Exact Mass | 254.06 |
| IUPAC Name | (2R,3S,5R)-5-(6-chloropurin-9-yl)-2-methyloxolan-3-ol |
| SMILES | C[C@H]1O[C@@H](n2cnc3c(Cl)ncnc32)C[C@@H]1O |
| InChI | InChI=1S/C10H11ClN4O2/c1-5-6(16)2-7(17-5)15-4-14-8-9(11)12-3-13-10(8)15/h3-7,16H,2H2,1H3/t5-,6+,7-/m1/s1 |
| InChIKey | KVCXAIANQANTNQ-DSYKOEDSSA-N |
| XLogP | 1.15 |
| TPSA | 73.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.68 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |