C18H27ClN4O3Si — CID 140822398
9-[(4aR,6R,7aS)-2,2-ditert-butyl-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3,2]dioxasilin-6-yl]-6-chloropurine (PubChem CID 140822398) has the molecular formula C18H27ClN4O3Si and a molecular weight of 410.98 g/mol. Its IUPAC name is 9-[(4aR,6R,7aS)-2,2-ditert-butyl-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3,2]dioxasilin-6-yl]-6-chloropurine.
| Compound Name | 9-[(4aR,6R,7aS)-2,2-ditert-butyl-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3,2]dioxasilin-6-yl]-6-chloropurine |
|---|---|
| PubChem CID | 140822398 |
| Molecular Formula | C18H27ClN4O3Si |
| Molecular Weight | 410.98 g/mol |
| Exact Mass | 410.15 |
| IUPAC Name | 9-[(4aR,6R,7aS)-2,2-ditert-butyl-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3,2]dioxasilin-6-yl]-6-chloropurine |
| SMILES | CC(C)(C)[Si]1(C(C)(C)C)OC[C@H]2O[C@@H](n3cnc4c(Cl)ncnc43)C[C@@H]2O1 |
| InChI | InChI=1S/C18H27ClN4O3Si/c1-17(2,3)27(18(4,5)6)24-8-12-11(26-27)7-13(25-12)23-10-22-14-15(19)20-9-21-16(14)23/h9-13H,7-8H2,1-6H3/t11-,12+,13+/m0/s1 |
| InChIKey | HATKCNQNQKGXLO-YNEHKIRRSA-N |
| XLogP | 4.22 |
| TPSA | 71.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.98 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|