C26H45ClN4O4SSi2 — CID 10875739
9-[(6aR,8R,9R,9aR)-9-tert-butylsulfanyl-2,2,4,4-tetra(propan-2-yl)-6a,8,9,9a-tetrahydro-6H-furo[3,2-f][1,3,5,2,4]trioxadisilocin-8-yl]-6-chloropurine (PubChem CID 10875739) has the molecular formula C26H45ClN4O4SSi2 and a molecular weight of 601.36 g/mol. Its IUPAC name is 9-[(6aR,8R,9R,9aR)-9-tert-butylsulfanyl-2,2,4,4-tetra(propan-2-yl)-6a,8,9,9a-tetrahydro-6H-furo[3,2-f][1,3,5,2,4]trioxadisilocin-8-yl]-6-chloropurine.
| Compound Name | 9-[(6aR,8R,9R,9aR)-9-tert-butylsulfanyl-2,2,4,4-tetra(propan-2-yl)-6a,8,9,9a-tetrahydro-6H-furo[3,2-f][1,3,5,2,4]trioxadisilocin-8-yl]-6-chloropurine |
|---|---|
| PubChem CID | 10875739 |
| Molecular Formula | C26H45ClN4O4SSi2 |
| Molecular Weight | 601.36 g/mol |
| Exact Mass | 600.24 |
| IUPAC Name | 9-[(6aR,8R,9R,9aR)-9-tert-butylsulfanyl-2,2,4,4-tetra(propan-2-yl)-6a,8,9,9a-tetrahydro-6H-furo[3,2-f][1,3,5,2,4]trioxadisilocin-8-yl]-6-chloropurine |
| SMILES | CC(C)[Si]1(C(C)C)OC[C@H]2O[C@@H](n3cnc4c(Cl)ncnc43)[C@H](SC(C)(C)C)[C@@H]2O[Si](C(C)C)(C(C)C)O1 |
| InChI | InChI=1S/C26H45ClN4O4SSi2/c1-15(2)37(16(3)4)32-12-19-21(34-38(35-37,17(5)6)18(7)8)22(36-26(9,10)11)25(33-19)31-14-30-20-23(27)28-13-29-24(20)31/h13-19,21-22,25H,12H2,1-11H3/t19-,21-,22-,25-/m1/s1 |
| InChIKey | UYCNPDBEBHJSDM-PTGPVQHPSA-N |
| XLogP | 7.23 |
| TPSA | 80.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.36 |
| LogP ≤ 5 | 7.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|