C29H52ClN5O6Si3 — CID 166015859
N-[9-[(6aR,8R,9S)-2,2,4,4-tetra(propan-2-yl)-9-trimethylsilyloxy-6a,8,9,9a-tetrahydro-6H-furo[3,2-f][1,3,5,2,4]trioxadisilocin-8-yl]-6-chloropurin-2-yl]-2-methylpropanamide (PubChem CID 166015859) has the molecular formula C29H52ClN5O6Si3 and a molecular weight of 686.47 g/mol. Its IUPAC name is N-[9-[(6aR,8R,9S)-2,2,4,4-tetra(propan-2-yl)-9-trimethylsilyloxy-6a,8,9,9a-tetrahydro-6H-furo[3,2-f][1,3,5,2,4]trioxadisilocin-8-yl]-6-chloropurin-2-yl]-2-methylpropanamide.
| Compound Name | N-[9-[(6aR,8R,9S)-2,2,4,4-tetra(propan-2-yl)-9-trimethylsilyloxy-6a,8,9,9a-tetrahydro-6H-furo[3,2-f][1,3,5,2,4]trioxadisilocin-8-yl]-6-chloropurin-2-yl]-2-methylpropanamide |
|---|---|
| PubChem CID | 166015859 |
| Molecular Formula | C29H52ClN5O6Si3 |
| Molecular Weight | 686.47 g/mol |
| Exact Mass | 685.29 |
| IUPAC Name | N-[9-[(6aR,8R,9S)-2,2,4,4-tetra(propan-2-yl)-9-trimethylsilyloxy-6a,8,9,9a-tetrahydro-6H-furo[3,2-f][1,3,5,2,4]trioxadisilocin-8-yl]-6-chloropurin-2-yl]-2-methylpropanamide |
| SMILES | CC(C)C(=O)Nc1nc(Cl)c2ncn([C@@H]3O[C@@H]4CO[Si](C(C)C)(C(C)C)O[Si](C(C)C)(C(C)C)OC4[C@@H]3O[Si](C)(C)C)c2n1 |
| InChI | InChI=1S/C29H52ClN5O6Si3/c1-16(2)27(36)34-29-32-25(30)22-26(33-29)35(15-31-22)28-24(39-42(11,12)13)23-21(38-28)14-37-43(17(3)4,18(5)6)41-44(40-23,19(7)8)20(9)10/h15-21,23-24,28H,14H2,1-13H3,(H,32,33,34,36)/t21-,23?,24+,28-/m1/s1 |
| InChIKey | FCTKCGAQRSYBPI-XFSSTXOUSA-N |
| XLogP | 7.15 |
| TPSA | 118.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 686.47 |
| LogP ≤ 5 | 7.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|