C25H42N6O6Si2 — CID 10745779
3-[(6aR,8R,9R,9aR)-9-methoxy-2,2,4,4-tetra(propan-2-yl)-6a,8,9,9a-tetrahydro-6H-furo[3,2-f][1,3,5,2,4]trioxadisilocin-8-yl]-5-methyl-[1,2,4]triazolo[1,5-a]purin-9-one (PubChem CID 10745779) has the molecular formula C25H42N6O6Si2 and a molecular weight of 578.82 g/mol. Its IUPAC name is 3-[(6aR,8R,9R,9aR)-9-methoxy-2,2,4,4-tetra(propan-2-yl)-6a,8,9,9a-tetrahydro-6H-furo[3,2-f][1,3,5,2,4]trioxadisilocin-8-yl]-5-methyl-[1,2,4]triazolo[1,5-a]purin-9-one.
| Compound Name | 3-[(6aR,8R,9R,9aR)-9-methoxy-2,2,4,4-tetra(propan-2-yl)-6a,8,9,9a-tetrahydro-6H-furo[3,2-f][1,3,5,2,4]trioxadisilocin-8-yl]-5-methyl-[1,2,4]triazolo[1,5-a]purin-9-one |
|---|---|
| PubChem CID | 10745779 |
| Molecular Formula | C25H42N6O6Si2 |
| Molecular Weight | 578.82 g/mol |
| Exact Mass | 578.27 |
| IUPAC Name | 3-[(6aR,8R,9R,9aR)-9-methoxy-2,2,4,4-tetra(propan-2-yl)-6a,8,9,9a-tetrahydro-6H-furo[3,2-f][1,3,5,2,4]trioxadisilocin-8-yl]-5-methyl-[1,2,4]triazolo[1,5-a]purin-9-one |
| SMILES | CO[C@@H]1[C@@H]2O[Si](C(C)C)(C(C)C)O[Si](C(C)C)(C(C)C)OC[C@H]2O[C@H]1n1cnc2c(=O)n3ncn(C)c3nc21 |
| InChI | InChI=1S/C25H42N6O6Si2/c1-14(2)38(15(3)4)34-11-18-20(36-39(37-38,16(5)6)17(7)8)21(33-10)24(35-18)30-12-26-19-22(30)28-25-29(9)13-27-31(25)23(19)32/h12-18,20-21,24H,11H2,1-10H3/t18-,20-,21-,24-/m1/s1 |
| InChIKey | HVEATCIFJLASNF-UMCMBGNQSA-N |
| XLogP | 3.65 |
| TPSA | 116.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.82 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|