C26H47N5O6Si2 — CID 153277565
9-[(6aR,9R)-9-hydroxy-2,2,4,4-tetra(propan-2-yl)-6a,8,9,9a-tetrahydro-6H-furo[3,2-f][1,3,5,2,4]trioxadisilocin-8-yl]-2-(2-methylpropylamino)-1H-purin-6-one (PubChem CID 153277565) has the molecular formula C26H47N5O6Si2 and a molecular weight of 581.86 g/mol. Its IUPAC name is 9-[(6aR,9R)-9-hydroxy-2,2,4,4-tetra(propan-2-yl)-6a,8,9,9a-tetrahydro-6H-furo[3,2-f][1,3,5,2,4]trioxadisilocin-8-yl]-2-(2-methylpropylamino)-1H-purin-6-one.
| Compound Name | 9-[(6aR,9R)-9-hydroxy-2,2,4,4-tetra(propan-2-yl)-6a,8,9,9a-tetrahydro-6H-furo[3,2-f][1,3,5,2,4]trioxadisilocin-8-yl]-2-(2-methylpropylamino)-1H-purin-6-one |
|---|---|
| PubChem CID | 153277565 |
| Molecular Formula | C26H47N5O6Si2 |
| Molecular Weight | 581.86 g/mol |
| Exact Mass | 581.31 |
| IUPAC Name | 9-[(6aR,9R)-9-hydroxy-2,2,4,4-tetra(propan-2-yl)-6a,8,9,9a-tetrahydro-6H-furo[3,2-f][1,3,5,2,4]trioxadisilocin-8-yl]-2-(2-methylpropylamino)-1H-purin-6-one |
| SMILES | CC(C)CNc1nc2c(ncn2C2O[C@@H]3CO[Si](C(C)C)(C(C)C)O[Si](C(C)C)(C(C)C)OC3[C@H]2O)c(=O)[nH]1 |
| InChI | InChI=1S/C26H47N5O6Si2/c1-14(2)11-27-26-29-23-20(24(33)30-26)28-13-31(23)25-21(32)22-19(35-25)12-34-38(15(3)4,16(5)6)37-39(36-22,17(7)8)18(9)10/h13-19,21-22,25,32H,11-12H2,1-10H3,(H2,27,29,30,33)/t19-,21-,22?,25?/m1/s1 |
| InChIKey | WADRQPGHFMBQCQ-AYBKPZKCSA-N |
| XLogP | 4.40 |
| TPSA | 132.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.86 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|