C21H37N5O4Si — CID 160540373
9-[(3R,4R,5R)-3-[tert-butyl(dimethyl)silyl]oxy-5-ethyl-4-hydroxyoxolan-2-yl]-2-(2-methylpropylamino)-1H-purin-6-one (PubChem CID 160540373) has the molecular formula C21H37N5O4Si and a molecular weight of 451.64 g/mol. Its IUPAC name is 9-[(3R,4R,5R)-3-[tert-butyl(dimethyl)silyl]oxy-5-ethyl-4-hydroxyoxolan-2-yl]-2-(2-methylpropylamino)-1H-purin-6-one.
| Compound Name | 9-[(3R,4R,5R)-3-[tert-butyl(dimethyl)silyl]oxy-5-ethyl-4-hydroxyoxolan-2-yl]-2-(2-methylpropylamino)-1H-purin-6-one |
|---|---|
| PubChem CID | 160540373 |
| Molecular Formula | C21H37N5O4Si |
| Molecular Weight | 451.64 g/mol |
| Exact Mass | 451.26 |
| IUPAC Name | 9-[(3R,4R,5R)-3-[tert-butyl(dimethyl)silyl]oxy-5-ethyl-4-hydroxyoxolan-2-yl]-2-(2-methylpropylamino)-1H-purin-6-one |
| SMILES | CC[C@H]1OC(n2cnc3c(=O)[nH]c(NCC(C)C)nc32)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O |
| InChI | InChI=1S/C21H37N5O4Si/c1-9-13-15(27)16(30-31(7,8)21(4,5)6)19(29-13)26-11-23-14-17(26)24-20(25-18(14)28)22-10-12(2)3/h11-13,15-16,19,27H,9-10H2,1-8H3,(H2,22,24,25,28)/t13-,15-,16-,19?/m1/s1 |
| InChIKey | KLQZUUHBTAQWSH-XAUNWSGPSA-N |
| XLogP | 3.25 |
| TPSA | 114.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.64 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|