C21H34N6O5 — CID 137060408
N-[9-[(2R,3S,5R)-3-(6-aminohexoxy)-5-ethyl-4-hydroxyoxolan-2-yl]-6-oxo-1H-purin-2-yl]-2-methylpropanamide (PubChem CID 137060408) has the molecular formula C21H34N6O5 and a molecular weight of 450.54 g/mol. Its IUPAC name is N-[9-[(2R,3S,5R)-3-(6-aminohexoxy)-5-ethyl-4-hydroxyoxolan-2-yl]-6-oxo-1H-purin-2-yl]-2-methylpropanamide.
| Compound Name | N-[9-[(2R,3S,5R)-3-(6-aminohexoxy)-5-ethyl-4-hydroxyoxolan-2-yl]-6-oxo-1H-purin-2-yl]-2-methylpropanamide |
|---|---|
| PubChem CID | 137060408 |
| Molecular Formula | C21H34N6O5 |
| Molecular Weight | 450.54 g/mol |
| Exact Mass | 450.26 |
| IUPAC Name | N-[9-[(2R,3S,5R)-3-(6-aminohexoxy)-5-ethyl-4-hydroxyoxolan-2-yl]-6-oxo-1H-purin-2-yl]-2-methylpropanamide |
| SMILES | CC[C@H]1O[C@@H](n2cnc3c(=O)[nH]c(NC(=O)C(C)C)nc32)[C@@H](OCCCCCCN)C1O |
| InChI | InChI=1S/C21H34N6O5/c1-4-13-15(28)16(31-10-8-6-5-7-9-22)20(32-13)27-11-23-14-17(27)24-21(26-19(14)30)25-18(29)12(2)3/h11-13,15-16,20,28H,4-10,22H2,1-3H3,(H2,24,25,26,29,30)/t13-,15?,16+,20-/m1/s1 |
| InChIKey | RTESKELEASPOEM-YPDTUTPGSA-N |
| XLogP | 1.29 |
| TPSA | 157.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.54 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|