C22H31N5O9 — CID 136898123
[(2R,3R,4R,5R)-4-(ethoxymethoxy)-3-hydroxy-5-[2-(2-methylpropanoylamino)-6-oxo-1H-purin-9-yl]oxolan-2-yl]methyl 4-oxopentanoate (PubChem CID 136898123) has the molecular formula C22H31N5O9 and a molecular weight of 509.52 g/mol. Its IUPAC name is [(2R,3R,4R,5R)-4-(ethoxymethoxy)-3-hydroxy-5-[2-(2-methylpropanoylamino)-6-oxo-1H-purin-9-yl]oxolan-2-yl]methyl 4-oxopentanoate.
| Compound Name | [(2R,3R,4R,5R)-4-(ethoxymethoxy)-3-hydroxy-5-[2-(2-methylpropanoylamino)-6-oxo-1H-purin-9-yl]oxolan-2-yl]methyl 4-oxopentanoate |
|---|---|
| PubChem CID | 136898123 |
| Molecular Formula | C22H31N5O9 |
| Molecular Weight | 509.52 g/mol |
| Exact Mass | 509.21 |
| IUPAC Name | [(2R,3R,4R,5R)-4-(ethoxymethoxy)-3-hydroxy-5-[2-(2-methylpropanoylamino)-6-oxo-1H-purin-9-yl]oxolan-2-yl]methyl 4-oxopentanoate |
| SMILES | CCOCO[C@@H]1[C@H](O)[C@@H](COC(=O)CCC(C)=O)O[C@H]1n1cnc2c(=O)[nH]c(NC(=O)C(C)C)nc21 |
| InChI | InChI=1S/C22H31N5O9/c1-5-33-10-35-17-16(30)13(8-34-14(29)7-6-12(4)28)36-21(17)27-9-23-15-18(27)24-22(26-20(15)32)25-19(31)11(2)3/h9,11,13,16-17,21,30H,5-8,10H2,1-4H3,(H2,24,25,26,31,32)/t13-,16-,17-,21-/m1/s1 |
| InChIKey | VPOOQQNIFGUWCK-TXRZWFJJSA-N |
| XLogP | 0.26 |
| TPSA | 183.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.52 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|