C20H28N8O6 — CID 162779354
[(2S,3R,4R,5R)-3-azido-4-ethoxy-5-[2-(2-methylpropanoylamino)-6-oxo-1H-purin-9-yl]oxolan-2-yl]methyl 2-methylpropanoate (PubChem CID 162779354) has the molecular formula C20H28N8O6 and a molecular weight of 476.49 g/mol. Its IUPAC name is [(2S,3R,4R,5R)-3-azido-4-ethoxy-5-[2-(2-methylpropanoylamino)-6-oxo-1H-purin-9-yl]oxolan-2-yl]methyl 2-methylpropanoate.
| Compound Name | [(2S,3R,4R,5R)-3-azido-4-ethoxy-5-[2-(2-methylpropanoylamino)-6-oxo-1H-purin-9-yl]oxolan-2-yl]methyl 2-methylpropanoate |
|---|---|
| PubChem CID | 162779354 |
| Molecular Formula | C20H28N8O6 |
| Molecular Weight | 476.49 g/mol |
| Exact Mass | 476.21 |
| IUPAC Name | [(2S,3R,4R,5R)-3-azido-4-ethoxy-5-[2-(2-methylpropanoylamino)-6-oxo-1H-purin-9-yl]oxolan-2-yl]methyl 2-methylpropanoate |
| SMILES | CCO[C@@H]1[C@H](N=[N+]=[N-])[C@@H](COC(=O)C(C)C)O[C@H]1n1cnc2c(=O)[nH]c(NC(=O)C(C)C)nc21 |
| InChI | InChI=1S/C20H28N8O6/c1-6-32-14-12(26-27-21)11(7-33-19(31)10(4)5)34-18(14)28-8-22-13-15(28)23-20(25-17(13)30)24-16(29)9(2)3/h8-12,14,18H,6-7H2,1-5H3,(H2,23,24,25,29,30)/t11-,12-,14-,18-/m1/s1 |
| InChIKey | POHGPHLWXBUMDT-LZDVPDMXSA-N |
| XLogP | 1.89 |
| TPSA | 186.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.49 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|