C16H23N8O8P — CID 162423274
[(2R,3R,4R,5S)-4-(2-azidoethyl)-5-(hydroxymethyl)-2-[2-(2-methylpropanoylamino)-6-oxo-1H-purin-9-yl]oxolan-3-yl] dihydrogen phosphate (PubChem CID 162423274) has the molecular formula C16H23N8O8P and a molecular weight of 486.38 g/mol. Its IUPAC name is [(2R,3R,4R,5S)-4-(2-azidoethyl)-5-(hydroxymethyl)-2-[2-(2-methylpropanoylamino)-6-oxo-1H-purin-9-yl]oxolan-3-yl] dihydrogen phosphate.
| Compound Name | [(2R,3R,4R,5S)-4-(2-azidoethyl)-5-(hydroxymethyl)-2-[2-(2-methylpropanoylamino)-6-oxo-1H-purin-9-yl]oxolan-3-yl] dihydrogen phosphate |
|---|---|
| PubChem CID | 162423274 |
| Molecular Formula | C16H23N8O8P |
| Molecular Weight | 486.38 g/mol |
| Exact Mass | 486.14 |
| IUPAC Name | [(2R,3R,4R,5S)-4-(2-azidoethyl)-5-(hydroxymethyl)-2-[2-(2-methylpropanoylamino)-6-oxo-1H-purin-9-yl]oxolan-3-yl] dihydrogen phosphate |
| SMILES | CC(C)C(=O)Nc1nc2c(ncn2[C@@H]2O[C@H](CO)[C@@H](CCN=[N+]=[N-])[C@H]2OP(=O)(O)O)c(=O)[nH]1 |
| InChI | InChI=1S/C16H23N8O8P/c1-7(2)13(26)21-16-20-12-10(14(27)22-16)18-6-24(12)15-11(32-33(28,29)30)8(3-4-19-23-17)9(5-25)31-15/h6-9,11,15,25H,3-5H2,1-2H3,(H2,28,29,30)(H2,20,21,22,26,27)/t8-,9-,11-,15-/m1/s1 |
| InChIKey | QBHNRXIRYLKDSS-XBMUNGEKSA-N |
| XLogP | 0.40 |
| TPSA | 237.65 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.38 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|